C18H18N2O — CID 13342088
5-benzyl-1,2,3,3a-tetrahydropyrrolo[1,2-a]quinoxalin-4-one (PubChem CID 13342088) has the molecular formula C18H18N2O and a molecular weight of 278.36 g/mol. Its IUPAC name is 5-benzyl-1,2,3,3a-tetrahydropyrrolo[1,2-a]quinoxalin-4-one.
| Compound Name | 5-benzyl-1,2,3,3a-tetrahydropyrrolo[1,2-a]quinoxalin-4-one |
|---|---|
| PubChem CID | 13342088 |
| Molecular Formula | C18H18N2O |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | 5-benzyl-1,2,3,3a-tetrahydropyrrolo[1,2-a]quinoxalin-4-one |
| SMILES | O=C1C2CCCN2c2ccccc2N1Cc1ccccc1 |
| InChI | InChI=1S/C18H18N2O/c21-18-17-11-6-12-19(17)15-9-4-5-10-16(15)20(18)13-14-7-2-1-3-8-14/h1-5,7-10,17H,6,11-13H2 |
| InChIKey | VQKILXRVARIHIW-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |