C11H18FN3OS — CID 133421053
2-[(6-ethyl-5-fluoropyrimidin-4-yl)amino]-4-methylsulfanylbutan-1-ol (PubChem CID 133421053) has the molecular formula C11H18FN3OS and a molecular weight of 259.35 g/mol. Its IUPAC name is 2-[(6-ethyl-5-fluoropyrimidin-4-yl)amino]-4-methylsulfanylbutan-1-ol.
| Compound Name | 2-[(6-ethyl-5-fluoropyrimidin-4-yl)amino]-4-methylsulfanylbutan-1-ol |
|---|---|
| PubChem CID | 133421053 |
| Molecular Formula | C11H18FN3OS |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | 2-[(6-ethyl-5-fluoropyrimidin-4-yl)amino]-4-methylsulfanylbutan-1-ol |
| SMILES | CCc1ncnc(NC(CO)CCSC)c1F |
| InChI | InChI=1S/C11H18FN3OS/c1-3-9-10(12)11(14-7-13-9)15-8(6-16)4-5-17-2/h7-8,16H,3-6H2,1-2H3,(H,13,14,15) |
| InChIKey | QWYSBZXRKJGJFT-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |