About 4-(3-nitroimidazo[1,2-b]pyridazin-6-yl)-1,9-dioxa-4-azaspiro[5.5]undecane
4-(3-nitroimidazo[1,2-b]pyridazin-6-yl)-1,9-dioxa-4-azaspiro[5.5]undecane (PubChem CID 133421191) has the molecular formula C14H17N5O4
and a molecular weight of 319.32 g/mol. Its IUPAC name is 4-(3-nitroimidazo[1,2-b]pyridazin-6-yl)-1,9-dioxa-4-azaspiro[5.5]undecane.
Molecular Properties
| Compound Name | 4-(3-nitroimidazo[1,2-b]pyridazin-6-yl)-1,9-dioxa-4-azaspiro[5.5]undecane |
| PubChem CID | 133421191 |
| Molecular Formula | C14H17N5O4 |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.13 |
| IUPAC Name | 4-(3-nitroimidazo[1,2-b]pyridazin-6-yl)-1,9-dioxa-4-azaspiro[5.5]undecane |
| SMILES | O=[N+]([O-])c1cnc2ccc(N3CCOC4(CCOCC4)C3)nn12 |
| InChI | InChI=1S/C14H17N5O4/c20-19(21)13-9-15-11-1-2-12(16-18(11)13)17-5-8-23-14(10-17)3-6-22-7-4-14/h1-2,9H,3-8,10H2 |
| InChIKey | XTUVHCLFNUPYRO-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 95.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(3-nitroimidazo[1,2-b]pyridazin-6-yl)-1,9-dioxa-4-azaspiro[5.5]undecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-nitroimidazo[1,2-b]pyridazin-6-yl)-1,9-dioxa-4-azaspiro[5.5]undecane?
The IUPAC name of 4-(3-nitroimidazo[1,2-b]pyridazin-6-yl)-1,9-dioxa-4-azaspiro[5.5]undecane (CID 133421191) is 4-(3-nitroimidazo[1,2-b]pyridazin-6-yl)-1,9-dioxa-4-azaspiro[5.5]undecane.
What is the SMILES notation for 4-(3-nitroimidazo[1,2-b]pyridazin-6-yl)-1,9-dioxa-4-azaspiro[5.5]undecane?
The canonical SMILES for 4-(3-nitroimidazo[1,2-b]pyridazin-6-yl)-1,9-dioxa-4-azaspiro[5.5]undecane is O=[N+]([O-])c1cnc2ccc(N3CCOC4(CCOCC4)C3)nn12.
What is the InChIKey of 4-(3-nitroimidazo[1,2-b]pyridazin-6-yl)-1,9-dioxa-4-azaspiro[5.5]undecane?
The InChIKey is XTUVHCLFNUPYRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17N5O4/c20-19(21)13-9-15-11-1-2-12(16-18(11)13)17-5-8-23-14(10-17)3-6-22-7-4-14/h1-2,9H,3-8,10H2.
What are the key properties of 4-(3-nitroimidazo[1,2-b]pyridazin-6-yl)-1,9-dioxa-4-azaspiro[5.5]undecane?
4-(3-nitroimidazo[1,2-b]pyridazin-6-yl)-1,9-dioxa-4-azaspiro[5.5]undecane has a molecular weight of 319.32 g/mol, XLogP of 1.02, 2 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-nitroimidazo[1,2-b]pyridazin-6-yl)-1,9-dioxa-4-azaspiro[5.5]undecane is sourced from PubChem (CID 133421191), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).