About 1-(4-ethoxypyrimidin-2-yl)-4-[6-(trifluoromethyl)pyridazin-3-yl]-1,4-diazepane
1-(4-ethoxypyrimidin-2-yl)-4-[6-(trifluoromethyl)pyridazin-3-yl]-1,4-diazepane (PubChem CID 133421206) has the molecular formula C16H19F3N6O
and a molecular weight of 368.36 g/mol. Its IUPAC name is 1-(4-ethoxypyrimidin-2-yl)-4-[6-(trifluoromethyl)pyridazin-3-yl]-1,4-diazepane.
Molecular Properties
| Compound Name | 1-(4-ethoxypyrimidin-2-yl)-4-[6-(trifluoromethyl)pyridazin-3-yl]-1,4-diazepane |
| PubChem CID | 133421206 |
| Molecular Formula | C16H19F3N6O |
| Molecular Weight | 368.36 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | 1-(4-ethoxypyrimidin-2-yl)-4-[6-(trifluoromethyl)pyridazin-3-yl]-1,4-diazepane |
| SMILES | CCOc1ccnc(N2CCCN(c3ccc(C(F)(F)F)nn3)CC2)n1 |
| InChI | InChI=1S/C16H19F3N6O/c1-2-26-14-6-7-20-15(21-14)25-9-3-8-24(10-11-25)13-5-4-12(22-23-13)16(17,18)19/h4-7H,2-3,8-11H2,1H3 |
| InChIKey | DDGLFVPZOLISHA-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 67.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.36 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1-(4-ethoxypyrimidin-2-yl)-4-[6-(trifluoromethyl)pyridazin-3-yl]-1,4-diazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-ethoxypyrimidin-2-yl)-4-[6-(trifluoromethyl)pyridazin-3-yl]-1,4-diazepane?
The IUPAC name of 1-(4-ethoxypyrimidin-2-yl)-4-[6-(trifluoromethyl)pyridazin-3-yl]-1,4-diazepane (CID 133421206) is 1-(4-ethoxypyrimidin-2-yl)-4-[6-(trifluoromethyl)pyridazin-3-yl]-1,4-diazepane.
What is the SMILES notation for 1-(4-ethoxypyrimidin-2-yl)-4-[6-(trifluoromethyl)pyridazin-3-yl]-1,4-diazepane?
The canonical SMILES for 1-(4-ethoxypyrimidin-2-yl)-4-[6-(trifluoromethyl)pyridazin-3-yl]-1,4-diazepane is CCOc1ccnc(N2CCCN(c3ccc(C(F)(F)F)nn3)CC2)n1.
What is the InChIKey of 1-(4-ethoxypyrimidin-2-yl)-4-[6-(trifluoromethyl)pyridazin-3-yl]-1,4-diazepane?
The InChIKey is DDGLFVPZOLISHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19F3N6O/c1-2-26-14-6-7-20-15(21-14)25-9-3-8-24(10-11-25)13-5-4-12(22-23-13)16(17,18)19/h4-7H,2-3,8-11H2,1H3.
What are the key properties of 1-(4-ethoxypyrimidin-2-yl)-4-[6-(trifluoromethyl)pyridazin-3-yl]-1,4-diazepane?
1-(4-ethoxypyrimidin-2-yl)-4-[6-(trifluoromethyl)pyridazin-3-yl]-1,4-diazepane has a molecular weight of 368.36 g/mol, XLogP of 2.40, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-ethoxypyrimidin-2-yl)-4-[6-(trifluoromethyl)pyridazin-3-yl]-1,4-diazepane is sourced from PubChem (CID 133421206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).