C16H27N5O — CID 133421235
4-(2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-6-yl)-N,N-dimethyl-6-propan-2-yl-1,3,5-triazin-2-amine (PubChem CID 133421235) has the molecular formula C16H27N5O and a molecular weight of 305.43 g/mol. Its IUPAC name is 4-(2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-6-yl)-N,N-dimethyl-6-propan-2-yl-1,3,5-triazin-2-amine.
| Compound Name | 4-(2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-6-yl)-N,N-dimethyl-6-propan-2-yl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 133421235 |
| Molecular Formula | C16H27N5O |
| Molecular Weight | 305.43 g/mol |
| Exact Mass | 305.22 |
| IUPAC Name | 4-(2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-6-yl)-N,N-dimethyl-6-propan-2-yl-1,3,5-triazin-2-amine |
| SMILES | CC(C)c1nc(N(C)C)nc(N2CCC3OCCCC3C2)n1 |
| InChI | InChI=1S/C16H27N5O/c1-11(2)14-17-15(20(3)4)19-16(18-14)21-8-7-13-12(10-21)6-5-9-22-13/h11-13H,5-10H2,1-4H3 |
| InChIKey | QYIORIURVCTLQI-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 54.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.43 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |