C19H19N7O2 — CID 133421702
N-[1-(5-methyl-2-phenylpyrazol-3-yl)propan-2-yl]-3-nitroimidazo[1,2-b]pyridazin-6-amine (PubChem CID 133421702) has the molecular formula C19H19N7O2 and a molecular weight of 377.41 g/mol. Its IUPAC name is N-[1-(5-methyl-2-phenylpyrazol-3-yl)propan-2-yl]-3-nitroimidazo[1,2-b]pyridazin-6-amine.
| Compound Name | N-[1-(5-methyl-2-phenylpyrazol-3-yl)propan-2-yl]-3-nitroimidazo[1,2-b]pyridazin-6-amine |
|---|---|
| PubChem CID | 133421702 |
| Molecular Formula | C19H19N7O2 |
| Molecular Weight | 377.41 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | N-[1-(5-methyl-2-phenylpyrazol-3-yl)propan-2-yl]-3-nitroimidazo[1,2-b]pyridazin-6-amine |
| SMILES | Cc1cc(CC(C)Nc2ccc3ncc([N+](=O)[O-])n3n2)n(-c2ccccc2)n1 |
| InChI | InChI=1S/C19H19N7O2/c1-13(10-16-11-14(2)22-24(16)15-6-4-3-5-7-15)21-17-8-9-18-20-12-19(26(27)28)25(18)23-17/h3-9,11-13H,10H2,1-2H3,(H,21,23) |
| InChIKey | GIOVYSCIICSMJT-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 103.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.41 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|