C19H32N6 — CID 133421718
4-(1-cyclopropyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)-N,N-dimethyl-6-propan-2-yl-1,3,5-triazin-2-amine (PubChem CID 133421718) has the molecular formula C19H32N6 and a molecular weight of 344.51 g/mol. Its IUPAC name is 4-(1-cyclopropyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)-N,N-dimethyl-6-propan-2-yl-1,3,5-triazin-2-amine.
| Compound Name | 4-(1-cyclopropyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)-N,N-dimethyl-6-propan-2-yl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 133421718 |
| Molecular Formula | C19H32N6 |
| Molecular Weight | 344.51 g/mol |
| Exact Mass | 344.27 |
| IUPAC Name | 4-(1-cyclopropyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)-N,N-dimethyl-6-propan-2-yl-1,3,5-triazin-2-amine |
| SMILES | CC(C)c1nc(N(C)C)nc(N2CCC3C(CCCN3C3CC3)C2)n1 |
| InChI | InChI=1S/C19H32N6/c1-13(2)17-20-18(23(3)4)22-19(21-17)24-11-9-16-14(12-24)6-5-10-25(16)15-7-8-15/h13-16H,5-12H2,1-4H3 |
| InChIKey | YBCDRFVCRMIENR-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 48.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.51 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |