C11H9F3N6 — CID 133421869
6-[[1-methyl-3-(trifluoromethyl)pyrazol-4-yl]methylamino]pyridazine-3-carbonitrile (PubChem CID 133421869) has the molecular formula C11H9F3N6 and a molecular weight of 282.23 g/mol. Its IUPAC name is 6-[[1-methyl-3-(trifluoromethyl)pyrazol-4-yl]methylamino]pyridazine-3-carbonitrile.
| Compound Name | 6-[[1-methyl-3-(trifluoromethyl)pyrazol-4-yl]methylamino]pyridazine-3-carbonitrile |
|---|---|
| PubChem CID | 133421869 |
| Molecular Formula | C11H9F3N6 |
| Molecular Weight | 282.23 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | 6-[[1-methyl-3-(trifluoromethyl)pyrazol-4-yl]methylamino]pyridazine-3-carbonitrile |
| SMILES | Cn1cc(CNc2ccc(C#N)nn2)c(C(F)(F)F)n1 |
| InChI | InChI=1S/C11H9F3N6/c1-20-6-7(10(19-20)11(12,13)14)5-16-9-3-2-8(4-15)17-18-9/h2-3,6H,5H2,1H3,(H,16,18) |
| InChIKey | TYMVXOCDTGBYIX-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 79.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.23 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |