C13H22ClNO — CID 13342304
2-chloro-N-methyl-N-(3,3,5,5-tetramethylcyclohexen-1-yl)acetamide (PubChem CID 13342304) has the molecular formula C13H22ClNO and a molecular weight of 243.78 g/mol. Its IUPAC name is 2-chloro-N-methyl-N-(3,3,5,5-tetramethylcyclohexen-1-yl)acetamide.
| Compound Name | 2-chloro-N-methyl-N-(3,3,5,5-tetramethylcyclohexen-1-yl)acetamide |
|---|---|
| PubChem CID | 13342304 |
| Molecular Formula | C13H22ClNO |
| Molecular Weight | 243.78 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | 2-chloro-N-methyl-N-(3,3,5,5-tetramethylcyclohexen-1-yl)acetamide |
| SMILES | CN(C(=O)CCl)C1=CC(C)(C)CC(C)(C)C1 |
| InChI | InChI=1S/C13H22ClNO/c1-12(2)6-10(7-13(3,4)9-12)15(5)11(16)8-14/h6H,7-9H2,1-5H3 |
| InChIKey | RJHBBWPKAAXRMO-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.78 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|