About N-cyclohexyl-3-ethyl-N,1-dimethyl-4-nitropyrazol-5-amine
N-cyclohexyl-3-ethyl-N,1-dimethyl-4-nitropyrazol-5-amine (PubChem CID 133423374) has the molecular formula C13H22N4O2
and a molecular weight of 266.34 g/mol. Its IUPAC name is N-cyclohexyl-3-ethyl-N,1-dimethyl-4-nitropyrazol-5-amine.
Molecular Properties
| Compound Name | N-cyclohexyl-3-ethyl-N,1-dimethyl-4-nitropyrazol-5-amine |
| PubChem CID | 133423374 |
| Molecular Formula | C13H22N4O2 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | N-cyclohexyl-3-ethyl-N,1-dimethyl-4-nitropyrazol-5-amine |
| SMILES | CCc1nn(C)c(N(C)C2CCCCC2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C13H22N4O2/c1-4-11-12(17(18)19)13(16(3)14-11)15(2)10-8-6-5-7-9-10/h10H,4-9H2,1-3H3 |
| InChIKey | GURFQSSJIDRUBX-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 64.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-cyclohexyl-3-ethyl-N,1-dimethyl-4-nitropyrazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohexyl-3-ethyl-N,1-dimethyl-4-nitropyrazol-5-amine?
The IUPAC name of N-cyclohexyl-3-ethyl-N,1-dimethyl-4-nitropyrazol-5-amine (CID 133423374) is N-cyclohexyl-3-ethyl-N,1-dimethyl-4-nitropyrazol-5-amine.
What is the SMILES notation for N-cyclohexyl-3-ethyl-N,1-dimethyl-4-nitropyrazol-5-amine?
The canonical SMILES for N-cyclohexyl-3-ethyl-N,1-dimethyl-4-nitropyrazol-5-amine is CCc1nn(C)c(N(C)C2CCCCC2)c1[N+](=O)[O-].
What is the InChIKey of N-cyclohexyl-3-ethyl-N,1-dimethyl-4-nitropyrazol-5-amine?
The InChIKey is GURFQSSJIDRUBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N4O2/c1-4-11-12(17(18)19)13(16(3)14-11)15(2)10-8-6-5-7-9-10/h10H,4-9H2,1-3H3.
What are the key properties of N-cyclohexyl-3-ethyl-N,1-dimethyl-4-nitropyrazol-5-amine?
N-cyclohexyl-3-ethyl-N,1-dimethyl-4-nitropyrazol-5-amine has a molecular weight of 266.34 g/mol, XLogP of 2.66, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohexyl-3-ethyl-N,1-dimethyl-4-nitropyrazol-5-amine is sourced from PubChem (CID 133423374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).