C13H11ClN2O4S — CID 133424442
methyl 2-(4-acetamidophenoxy)-4-chloro-1,3-thiazole-5-carboxylate (PubChem CID 133424442) has the molecular formula C13H11ClN2O4S and a molecular weight of 326.76 g/mol. Its IUPAC name is methyl 2-(4-acetamidophenoxy)-4-chloro-1,3-thiazole-5-carboxylate.
| Compound Name | methyl 2-(4-acetamidophenoxy)-4-chloro-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 133424442 |
| Molecular Formula | C13H11ClN2O4S |
| Molecular Weight | 326.76 g/mol |
| Exact Mass | 326.01 |
| IUPAC Name | methyl 2-(4-acetamidophenoxy)-4-chloro-1,3-thiazole-5-carboxylate |
| SMILES | COC(=O)c1sc(Oc2ccc(NC(C)=O)cc2)nc1Cl |
| InChI | InChI=1S/C13H11ClN2O4S/c1-7(17)15-8-3-5-9(6-4-8)20-13-16-11(14)10(21-13)12(18)19-2/h3-6H,1-2H3,(H,15,17) |
| InChIKey | DCNNRASIICUDEH-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.76 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |