C19H12F2N6O4 — CID 133424443
N-[4-[[3-(difluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]oxy]phenyl]-3-nitrobenzamide (PubChem CID 133424443) has the molecular formula C19H12F2N6O4 and a molecular weight of 426.34 g/mol. Its IUPAC name is N-[4-[[3-(difluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]oxy]phenyl]-3-nitrobenzamide.
| Compound Name | N-[4-[[3-(difluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]oxy]phenyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 133424443 |
| Molecular Formula | C19H12F2N6O4 |
| Molecular Weight | 426.34 g/mol |
| Exact Mass | 426.09 |
| IUPAC Name | N-[4-[[3-(difluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]oxy]phenyl]-3-nitrobenzamide |
| SMILES | O=C(Nc1ccc(Oc2ccc3nnc(C(F)F)n3n2)cc1)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H12F2N6O4/c20-17(21)18-24-23-15-8-9-16(25-26(15)18)31-14-6-4-12(5-7-14)22-19(28)11-2-1-3-13(10-11)27(29)30/h1-10,17H,(H,22,28) |
| InChIKey | VJWLOSZPDHOARU-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 124.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.34 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|