C15H8F2N4O3 — CID 133424541
7-[[3-(difluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]oxy]chromen-2-one (PubChem CID 133424541) has the molecular formula C15H8F2N4O3 and a molecular weight of 330.25 g/mol. Its IUPAC name is 7-[[3-(difluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]oxy]chromen-2-one.
| Compound Name | 7-[[3-(difluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]oxy]chromen-2-one |
|---|---|
| PubChem CID | 133424541 |
| Molecular Formula | C15H8F2N4O3 |
| Molecular Weight | 330.25 g/mol |
| Exact Mass | 330.06 |
| IUPAC Name | 7-[[3-(difluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]oxy]chromen-2-one |
| SMILES | O=c1ccc2ccc(Oc3ccc4nnc(C(F)F)n4n3)cc2o1 |
| InChI | InChI=1S/C15H8F2N4O3/c16-14(17)15-19-18-11-4-5-12(20-21(11)15)23-9-3-1-8-2-6-13(22)24-10(8)7-9/h1-7,14H |
| InChIKey | CRNHKEVGSOOLBD-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 82.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.25 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|