C19H8ClN3O5S — CID 133424634
3-chloro-5-[4-(4-nitrophenyl)-2-oxochromen-7-yl]oxy-1,2-thiazole-4-carbonitrile (PubChem CID 133424634) has the molecular formula C19H8ClN3O5S and a molecular weight of 425.81 g/mol. Its IUPAC name is 3-chloro-5-[4-(4-nitrophenyl)-2-oxochromen-7-yl]oxy-1,2-thiazole-4-carbonitrile.
| Compound Name | 3-chloro-5-[4-(4-nitrophenyl)-2-oxochromen-7-yl]oxy-1,2-thiazole-4-carbonitrile |
|---|---|
| PubChem CID | 133424634 |
| Molecular Formula | C19H8ClN3O5S |
| Molecular Weight | 425.81 g/mol |
| Exact Mass | 424.99 |
| IUPAC Name | 3-chloro-5-[4-(4-nitrophenyl)-2-oxochromen-7-yl]oxy-1,2-thiazole-4-carbonitrile |
| SMILES | N#Cc1c(Cl)nsc1Oc1ccc2c(-c3ccc([N+](=O)[O-])cc3)cc(=O)oc2c1 |
| InChI | InChI=1S/C19H8ClN3O5S/c20-18-15(9-21)19(29-22-18)27-12-5-6-13-14(8-17(24)28-16(13)7-12)10-1-3-11(4-2-10)23(25)26/h1-8H |
| InChIKey | LYJZHQKFKOCKRJ-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 119.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.81 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|