C13H7F2N5O4 — CID 133424640
4-[[3-(difluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]oxy]-3-nitrobenzaldehyde (PubChem CID 133424640) has the molecular formula C13H7F2N5O4 and a molecular weight of 335.23 g/mol. Its IUPAC name is 4-[[3-(difluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]oxy]-3-nitrobenzaldehyde.
| Compound Name | 4-[[3-(difluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]oxy]-3-nitrobenzaldehyde |
|---|---|
| PubChem CID | 133424640 |
| Molecular Formula | C13H7F2N5O4 |
| Molecular Weight | 335.23 g/mol |
| Exact Mass | 335.05 |
| IUPAC Name | 4-[[3-(difluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]oxy]-3-nitrobenzaldehyde |
| SMILES | O=Cc1ccc(Oc2ccc3nnc(C(F)F)n3n2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H7F2N5O4/c14-12(15)13-17-16-10-3-4-11(18-19(10)13)24-9-2-1-7(6-21)5-8(9)20(22)23/h1-6,12H |
| InChIKey | HCCWIQZTNSHGDR-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 112.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.23 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|