C15H10F3N5O4 — CID 133424644
4-[[7,8-dimethyl-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]oxy]-3-nitrobenzaldehyde (PubChem CID 133424644) has the molecular formula C15H10F3N5O4 and a molecular weight of 381.27 g/mol. Its IUPAC name is 4-[[7,8-dimethyl-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]oxy]-3-nitrobenzaldehyde.
| Compound Name | 4-[[7,8-dimethyl-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]oxy]-3-nitrobenzaldehyde |
|---|---|
| PubChem CID | 133424644 |
| Molecular Formula | C15H10F3N5O4 |
| Molecular Weight | 381.27 g/mol |
| Exact Mass | 381.07 |
| IUPAC Name | 4-[[7,8-dimethyl-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]oxy]-3-nitrobenzaldehyde |
| SMILES | Cc1c(Oc2ccc(C=O)cc2[N+](=O)[O-])nn2c(C(F)(F)F)nnc2c1C |
| InChI | InChI=1S/C15H10F3N5O4/c1-7-8(2)13(21-22-12(7)19-20-14(22)15(16,17)18)27-11-4-3-9(6-24)5-10(11)23(25)26/h3-6H,1-2H3 |
| InChIKey | YTHKTGOMFZWGNC-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 112.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.27 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|