C16H14FN5S2 — CID 133424878
[3-(2-fluorophenyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl] pyrrolidine-1-carbodithioate (PubChem CID 133424878) has the molecular formula C16H14FN5S2 and a molecular weight of 359.46 g/mol. Its IUPAC name is [3-(2-fluorophenyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl] pyrrolidine-1-carbodithioate.
| Compound Name | [3-(2-fluorophenyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl] pyrrolidine-1-carbodithioate |
|---|---|
| PubChem CID | 133424878 |
| Molecular Formula | C16H14FN5S2 |
| Molecular Weight | 359.46 g/mol |
| Exact Mass | 359.07 |
| IUPAC Name | [3-(2-fluorophenyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl] pyrrolidine-1-carbodithioate |
| SMILES | Fc1ccccc1-c1nnc2ccc(SC(=S)N3CCCC3)nn12 |
| InChI | InChI=1S/C16H14FN5S2/c17-12-6-2-1-5-11(12)15-19-18-13-7-8-14(20-22(13)15)24-16(23)21-9-3-4-10-21/h1-2,5-8H,3-4,9-10H2 |
| InChIKey | JOBJGXNYWPGCKP-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 46.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.46 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|