C17H16F2N4O2S2 — CID 133426122
5-[4-(difluoromethylsulfonyl)phenyl]sulfanyl-1-(4-propan-2-ylphenyl)tetrazole (PubChem CID 133426122) has the molecular formula C17H16F2N4O2S2 and a molecular weight of 410.47 g/mol. Its IUPAC name is 5-[4-(difluoromethylsulfonyl)phenyl]sulfanyl-1-(4-propan-2-ylphenyl)tetrazole.
| Compound Name | 5-[4-(difluoromethylsulfonyl)phenyl]sulfanyl-1-(4-propan-2-ylphenyl)tetrazole |
|---|---|
| PubChem CID | 133426122 |
| Molecular Formula | C17H16F2N4O2S2 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.07 |
| IUPAC Name | 5-[4-(difluoromethylsulfonyl)phenyl]sulfanyl-1-(4-propan-2-ylphenyl)tetrazole |
| SMILES | CC(C)c1ccc(-n2nnnc2Sc2ccc(S(=O)(=O)C(F)F)cc2)cc1 |
| InChI | InChI=1S/C17H16F2N4O2S2/c1-11(2)12-3-5-13(6-4-12)23-17(20-21-22-23)26-14-7-9-15(10-8-14)27(24,25)16(18)19/h3-11,16H,1-2H3 |
| InChIKey | FUGRQNPHKXFYRP-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 77.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |