C19H19N3O3S2 — CID 133428381
3-cyclopropyl-N-[4-(2-ethylsulfonylphenoxy)phenyl]-1,2,4-thiadiazol-5-amine (PubChem CID 133428381) has the molecular formula C19H19N3O3S2 and a molecular weight of 401.51 g/mol. Its IUPAC name is 3-cyclopropyl-N-[4-(2-ethylsulfonylphenoxy)phenyl]-1,2,4-thiadiazol-5-amine.
| Compound Name | 3-cyclopropyl-N-[4-(2-ethylsulfonylphenoxy)phenyl]-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 133428381 |
| Molecular Formula | C19H19N3O3S2 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.09 |
| IUPAC Name | 3-cyclopropyl-N-[4-(2-ethylsulfonylphenoxy)phenyl]-1,2,4-thiadiazol-5-amine |
| SMILES | CCS(=O)(=O)c1ccccc1Oc1ccc(Nc2nc(C3CC3)ns2)cc1 |
| InChI | InChI=1S/C19H19N3O3S2/c1-2-27(23,24)17-6-4-3-5-16(17)25-15-11-9-14(10-12-15)20-19-21-18(22-26-19)13-7-8-13/h3-6,9-13H,2,7-8H2,1H3,(H,20,21,22) |
| InChIKey | LBZYWSWFPDBKCQ-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |