C15H20F2N6 — CID 133429089
3-(difluoromethyl)-6-(3-ethyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-[1,2,4]triazolo[4,3-b]pyridazine (PubChem CID 133429089) has the molecular formula C15H20F2N6 and a molecular weight of 322.36 g/mol. Its IUPAC name is 3-(difluoromethyl)-6-(3-ethyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-[1,2,4]triazolo[4,3-b]pyridazine.
| Compound Name | 3-(difluoromethyl)-6-(3-ethyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-[1,2,4]triazolo[4,3-b]pyridazine |
|---|---|
| PubChem CID | 133429089 |
| Molecular Formula | C15H20F2N6 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | 3-(difluoromethyl)-6-(3-ethyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-[1,2,4]triazolo[4,3-b]pyridazine |
| SMILES | CCC1CN2CCCC2CN1c1ccc2nnc(C(F)F)n2n1 |
| InChI | InChI=1S/C15H20F2N6/c1-2-10-8-21-7-3-4-11(21)9-22(10)13-6-5-12-18-19-15(14(16)17)23(12)20-13/h5-6,10-11,14H,2-4,7-9H2,1H3 |
| InChIKey | OIZPDMXPGOGVSK-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 49.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |