C18H26N6O3 — CID 133429467
5-tert-butyl-3-[[4-(3-methyl-5-nitro-2-pyridinyl)-1,4-diazepan-1-yl]methyl]-1,2,4-oxadiazole (PubChem CID 133429467) has the molecular formula C18H26N6O3 and a molecular weight of 374.45 g/mol. Its IUPAC name is 5-tert-butyl-3-[[4-(3-methyl-5-nitro-2-pyridinyl)-1,4-diazepan-1-yl]methyl]-1,2,4-oxadiazole.
| Compound Name | 5-tert-butyl-3-[[4-(3-methyl-5-nitro-2-pyridinyl)-1,4-diazepan-1-yl]methyl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 133429467 |
| Molecular Formula | C18H26N6O3 |
| Molecular Weight | 374.45 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | 5-tert-butyl-3-[[4-(3-methyl-5-nitro-2-pyridinyl)-1,4-diazepan-1-yl]methyl]-1,2,4-oxadiazole |
| SMILES | Cc1cc([N+](=O)[O-])cnc1N1CCCN(Cc2noc(C(C)(C)C)n2)CC1 |
| InChI | InChI=1S/C18H26N6O3/c1-13-10-14(24(25)26)11-19-16(13)23-7-5-6-22(8-9-23)12-15-20-17(27-21-15)18(2,3)4/h10-11H,5-9,12H2,1-4H3 |
| InChIKey | VGQYYQSTXRBFKQ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 101.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.45 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|