About 4-[[(6-bromo-2,3-dimethylquinolin-4-yl)amino]methyl]oxane-4-carboxamide
4-[[(6-bromo-2,3-dimethylquinolin-4-yl)amino]methyl]oxane-4-carboxamide (PubChem CID 133430557) has the molecular formula C18H22BrN3O2
and a molecular weight of 392.30 g/mol. Its IUPAC name is 4-[[(6-bromo-2,3-dimethylquinolin-4-yl)amino]methyl]oxane-4-carboxamide.
Molecular Properties
| Compound Name | 4-[[(6-bromo-2,3-dimethylquinolin-4-yl)amino]methyl]oxane-4-carboxamide |
| PubChem CID | 133430557 |
| Molecular Formula | C18H22BrN3O2 |
| Molecular Weight | 392.30 g/mol |
| Exact Mass | 391.09 |
| IUPAC Name | 4-[[(6-bromo-2,3-dimethylquinolin-4-yl)amino]methyl]oxane-4-carboxamide |
| SMILES | Cc1nc2ccc(Br)cc2c(NCC2(C(N)=O)CCOCC2)c1C |
| InChI | InChI=1S/C18H22BrN3O2/c1-11-12(2)22-15-4-3-13(19)9-14(15)16(11)21-10-18(17(20)23)5-7-24-8-6-18/h3-4,9H,5-8,10H2,1-2H3,(H2,20,23)(H,21,22) |
| InChIKey | YXUVIQBLXWPXTJ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.30 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[[(6-bromo-2,3-dimethylquinolin-4-yl)amino]methyl]oxane-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[(6-bromo-2,3-dimethylquinolin-4-yl)amino]methyl]oxane-4-carboxamide?
The IUPAC name of 4-[[(6-bromo-2,3-dimethylquinolin-4-yl)amino]methyl]oxane-4-carboxamide (CID 133430557) is 4-[[(6-bromo-2,3-dimethylquinolin-4-yl)amino]methyl]oxane-4-carboxamide.
What is the SMILES notation for 4-[[(6-bromo-2,3-dimethylquinolin-4-yl)amino]methyl]oxane-4-carboxamide?
The canonical SMILES for 4-[[(6-bromo-2,3-dimethylquinolin-4-yl)amino]methyl]oxane-4-carboxamide is Cc1nc2ccc(Br)cc2c(NCC2(C(N)=O)CCOCC2)c1C.
What is the InChIKey of 4-[[(6-bromo-2,3-dimethylquinolin-4-yl)amino]methyl]oxane-4-carboxamide?
The InChIKey is YXUVIQBLXWPXTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22BrN3O2/c1-11-12(2)22-15-4-3-13(19)9-14(15)16(11)21-10-18(17(20)23)5-7-24-8-6-18/h3-4,9H,5-8,10H2,1-2H3,(H2,20,23)(H,21,22).
What are the key properties of 4-[[(6-bromo-2,3-dimethylquinolin-4-yl)amino]methyl]oxane-4-carboxamide?
4-[[(6-bromo-2,3-dimethylquinolin-4-yl)amino]methyl]oxane-4-carboxamide has a molecular weight of 392.30 g/mol, XLogP of 3.31, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[(6-bromo-2,3-dimethylquinolin-4-yl)amino]methyl]oxane-4-carboxamide is sourced from PubChem (CID 133430557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).