About 3-nitro-N-[3-(trifluoromethyl)cyclohexyl]imidazo[1,2-b]pyridazin-6-amine
3-nitro-N-[3-(trifluoromethyl)cyclohexyl]imidazo[1,2-b]pyridazin-6-amine (PubChem CID 133433210) has the molecular formula C13H14F3N5O2
and a molecular weight of 329.28 g/mol. Its IUPAC name is 3-nitro-N-[3-(trifluoromethyl)cyclohexyl]imidazo[1,2-b]pyridazin-6-amine.
Molecular Properties
| Compound Name | 3-nitro-N-[3-(trifluoromethyl)cyclohexyl]imidazo[1,2-b]pyridazin-6-amine |
| PubChem CID | 133433210 |
| Molecular Formula | C13H14F3N5O2 |
| Molecular Weight | 329.28 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | 3-nitro-N-[3-(trifluoromethyl)cyclohexyl]imidazo[1,2-b]pyridazin-6-amine |
| SMILES | O=[N+]([O-])c1cnc2ccc(NC3CCCC(C(F)(F)F)C3)nn12 |
| InChI | InChI=1S/C13H14F3N5O2/c14-13(15,16)8-2-1-3-9(6-8)18-10-4-5-11-17-7-12(21(22)23)20(11)19-10/h4-5,7-9H,1-3,6H2,(H,18,19) |
| InChIKey | KPOXTLYWRQKNMT-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.28 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-nitro-N-[3-(trifluoromethyl)cyclohexyl]imidazo[1,2-b]pyridazin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-nitro-N-[3-(trifluoromethyl)cyclohexyl]imidazo[1,2-b]pyridazin-6-amine?
The IUPAC name of 3-nitro-N-[3-(trifluoromethyl)cyclohexyl]imidazo[1,2-b]pyridazin-6-amine (CID 133433210) is 3-nitro-N-[3-(trifluoromethyl)cyclohexyl]imidazo[1,2-b]pyridazin-6-amine.
What is the SMILES notation for 3-nitro-N-[3-(trifluoromethyl)cyclohexyl]imidazo[1,2-b]pyridazin-6-amine?
The canonical SMILES for 3-nitro-N-[3-(trifluoromethyl)cyclohexyl]imidazo[1,2-b]pyridazin-6-amine is O=[N+]([O-])c1cnc2ccc(NC3CCCC(C(F)(F)F)C3)nn12.
What is the InChIKey of 3-nitro-N-[3-(trifluoromethyl)cyclohexyl]imidazo[1,2-b]pyridazin-6-amine?
The InChIKey is KPOXTLYWRQKNMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14F3N5O2/c14-13(15,16)8-2-1-3-9(6-8)18-10-4-5-11-17-7-12(21(22)23)20(11)19-10/h4-5,7-9H,1-3,6H2,(H,18,19).
What are the key properties of 3-nitro-N-[3-(trifluoromethyl)cyclohexyl]imidazo[1,2-b]pyridazin-6-amine?
3-nitro-N-[3-(trifluoromethyl)cyclohexyl]imidazo[1,2-b]pyridazin-6-amine has a molecular weight of 329.28 g/mol, XLogP of 3.17, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-nitro-N-[3-(trifluoromethyl)cyclohexyl]imidazo[1,2-b]pyridazin-6-amine is sourced from PubChem (CID 133433210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).