C10H10F3N5O3 — CID 133433497
3-nitro-N-[2-(2,2,2-trifluoroethoxy)ethyl]imidazo[1,2-b]pyridazin-6-amine (PubChem CID 133433497) has the molecular formula C10H10F3N5O3 and a molecular weight of 305.22 g/mol. Its IUPAC name is 3-nitro-N-[2-(2,2,2-trifluoroethoxy)ethyl]imidazo[1,2-b]pyridazin-6-amine.
| Compound Name | 3-nitro-N-[2-(2,2,2-trifluoroethoxy)ethyl]imidazo[1,2-b]pyridazin-6-amine |
|---|---|
| PubChem CID | 133433497 |
| Molecular Formula | C10H10F3N5O3 |
| Molecular Weight | 305.22 g/mol |
| Exact Mass | 305.07 |
| IUPAC Name | 3-nitro-N-[2-(2,2,2-trifluoroethoxy)ethyl]imidazo[1,2-b]pyridazin-6-amine |
| SMILES | O=[N+]([O-])c1cnc2ccc(NCCOCC(F)(F)F)nn12 |
| InChI | InChI=1S/C10H10F3N5O3/c11-10(12,13)6-21-4-3-14-7-1-2-8-15-5-9(18(19)20)17(8)16-7/h1-2,5H,3-4,6H2,(H,14,16) |
| InChIKey | PAAYHNRWHYAMBK-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.22 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|