About 4-(aminomethyl)benzene-1,2-diol;hydrobromide
4-(aminomethyl)benzene-1,2-diol;hydrobromide (PubChem CID 13343562) has the molecular formula C7H10BrNO2
and a molecular weight of 220.07 g/mol. Its IUPAC name is 4-(aminomethyl)benzene-1,2-diol;hydrobromide.
Molecular Properties
| Compound Name | 4-(aminomethyl)benzene-1,2-diol;hydrobromide |
| PubChem CID | 13343562 |
| Molecular Formula | C7H10BrNO2 |
| Molecular Weight | 220.07 g/mol |
| Exact Mass | 218.99 |
| IUPAC Name | 4-(aminomethyl)benzene-1,2-diol;hydrobromide |
| SMILES | Br.NCc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C7H9NO2.BrH/c8-4-5-1-2-6(9)7(10)3-5;/h1-3,9-10H,4,8H2;1H |
| InChIKey | BVFZTXFCZAXSHN-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.07 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 4-(aminomethyl)benzene-1,2-diol;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(aminomethyl)benzene-1,2-diol;hydrobromide?
The IUPAC name of 4-(aminomethyl)benzene-1,2-diol;hydrobromide (CID 13343562) is 4-(aminomethyl)benzene-1,2-diol;hydrobromide.
What is the SMILES notation for 4-(aminomethyl)benzene-1,2-diol;hydrobromide?
The canonical SMILES for 4-(aminomethyl)benzene-1,2-diol;hydrobromide is Br.NCc1ccc(O)c(O)c1.
What is the InChIKey of 4-(aminomethyl)benzene-1,2-diol;hydrobromide?
The InChIKey is BVFZTXFCZAXSHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO2.BrH/c8-4-5-1-2-6(9)7(10)3-5;/h1-3,9-10H,4,8H2;1H.
What are the key properties of 4-(aminomethyl)benzene-1,2-diol;hydrobromide?
4-(aminomethyl)benzene-1,2-diol;hydrobromide has a molecular weight of 220.07 g/mol, XLogP of 1.13, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(aminomethyl)benzene-1,2-diol;hydrobromide is sourced from PubChem (CID 13343562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).