C16H14ClF2N5O — CID 133435705
N-(8-chloro-2,3,4,5-tetrahydro-1-benzoxepin-5-yl)-3-(difluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-amine (PubChem CID 133435705) has the molecular formula C16H14ClF2N5O and a molecular weight of 365.77 g/mol. Its IUPAC name is N-(8-chloro-2,3,4,5-tetrahydro-1-benzoxepin-5-yl)-3-(difluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-amine.
| Compound Name | N-(8-chloro-2,3,4,5-tetrahydro-1-benzoxepin-5-yl)-3-(difluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-amine |
|---|---|
| PubChem CID | 133435705 |
| Molecular Formula | C16H14ClF2N5O |
| Molecular Weight | 365.77 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | N-(8-chloro-2,3,4,5-tetrahydro-1-benzoxepin-5-yl)-3-(difluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-amine |
| SMILES | FC(F)c1nnc2ccc(NC3CCCOc4cc(Cl)ccc43)nn12 |
| InChI | InChI=1S/C16H14ClF2N5O/c17-9-3-4-10-11(2-1-7-25-12(10)8-9)20-13-5-6-14-21-22-16(15(18)19)24(14)23-13/h3-6,8,11,15H,1-2,7H2,(H,20,23) |
| InChIKey | NSRFGXCSFWMOCT-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 64.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.77 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |