C20H24N4 — CID 133435800
5-(4-benzyl-3-propylpiperazin-1-yl)pyridine-2-carbonitrile (PubChem CID 133435800) has the molecular formula C20H24N4 and a molecular weight of 320.44 g/mol. Its IUPAC name is 5-(4-benzyl-3-propylpiperazin-1-yl)pyridine-2-carbonitrile.
| Compound Name | 5-(4-benzyl-3-propylpiperazin-1-yl)pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 133435800 |
| Molecular Formula | C20H24N4 |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | 5-(4-benzyl-3-propylpiperazin-1-yl)pyridine-2-carbonitrile |
| SMILES | CCCC1CN(c2ccc(C#N)nc2)CCN1Cc1ccccc1 |
| InChI | InChI=1S/C20H24N4/c1-2-6-20-16-24(19-10-9-18(13-21)22-14-19)12-11-23(20)15-17-7-4-3-5-8-17/h3-5,7-10,14,20H,2,6,11-12,15-16H2,1H3 |
| InChIKey | IKVCWJHFPHGWNB-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 43.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |