About 4-[4-(2,4-difluorophenyl)sulfonylpiperazin-1-yl]-2-methyl-8-nitroquinoline
4-[4-(2,4-difluorophenyl)sulfonylpiperazin-1-yl]-2-methyl-8-nitroquinoline (PubChem CID 133436339) has the molecular formula C20H18F2N4O4S
and a molecular weight of 448.45 g/mol. Its IUPAC name is 4-[4-(2,4-difluorophenyl)sulfonylpiperazin-1-yl]-2-methyl-8-nitroquinoline.
Molecular Properties
| Compound Name | 4-[4-(2,4-difluorophenyl)sulfonylpiperazin-1-yl]-2-methyl-8-nitroquinoline |
| PubChem CID | 133436339 |
| Molecular Formula | C20H18F2N4O4S |
| Molecular Weight | 448.45 g/mol |
| Exact Mass | 448.10 |
| IUPAC Name | 4-[4-(2,4-difluorophenyl)sulfonylpiperazin-1-yl]-2-methyl-8-nitroquinoline |
| SMILES | Cc1cc(N2CCN(S(=O)(=O)c3ccc(F)cc3F)CC2)c2cccc([N+](=O)[O-])c2n1 |
| InChI | InChI=1S/C20H18F2N4O4S/c1-13-11-18(15-3-2-4-17(26(27)28)20(15)23-13)24-7-9-25(10-8-24)31(29,30)19-6-5-14(21)12-16(19)22/h2-6,11-12H,7-10H2,1H3 |
| InChIKey | QEQGLGHTHRIHNK-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 96.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 448.45 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[4-(2,4-difluorophenyl)sulfonylpiperazin-1-yl]-2-methyl-8-nitroquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(2,4-difluorophenyl)sulfonylpiperazin-1-yl]-2-methyl-8-nitroquinoline?
The IUPAC name of 4-[4-(2,4-difluorophenyl)sulfonylpiperazin-1-yl]-2-methyl-8-nitroquinoline (CID 133436339) is 4-[4-(2,4-difluorophenyl)sulfonylpiperazin-1-yl]-2-methyl-8-nitroquinoline.
What is the SMILES notation for 4-[4-(2,4-difluorophenyl)sulfonylpiperazin-1-yl]-2-methyl-8-nitroquinoline?
The canonical SMILES for 4-[4-(2,4-difluorophenyl)sulfonylpiperazin-1-yl]-2-methyl-8-nitroquinoline is Cc1cc(N2CCN(S(=O)(=O)c3ccc(F)cc3F)CC2)c2cccc([N+](=O)[O-])c2n1.
What is the InChIKey of 4-[4-(2,4-difluorophenyl)sulfonylpiperazin-1-yl]-2-methyl-8-nitroquinoline?
The InChIKey is QEQGLGHTHRIHNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18F2N4O4S/c1-13-11-18(15-3-2-4-17(26(27)28)20(15)23-13)24-7-9-25(10-8-24)31(29,30)19-6-5-14(21)12-16(19)22/h2-6,11-12H,7-10H2,1H3.
What are the key properties of 4-[4-(2,4-difluorophenyl)sulfonylpiperazin-1-yl]-2-methyl-8-nitroquinoline?
4-[4-(2,4-difluorophenyl)sulfonylpiperazin-1-yl]-2-methyl-8-nitroquinoline has a molecular weight of 448.45 g/mol, XLogP of 3.24, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(2,4-difluorophenyl)sulfonylpiperazin-1-yl]-2-methyl-8-nitroquinoline is sourced from PubChem (CID 133436339), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).