C21H19ClN2O4S — CID 1334368
2-(4-chloro-N-(4-methoxyphenyl)sulfonylanilino)-N-phenylacetamide (PubChem CID 1334368) has the molecular formula C21H19ClN2O4S and a molecular weight of 430.91 g/mol. Its IUPAC name is 2-(4-chloro-N-(4-methoxyphenyl)sulfonylanilino)-N-phenylacetamide.
| Compound Name | 2-(4-chloro-N-(4-methoxyphenyl)sulfonylanilino)-N-phenylacetamide |
|---|---|
| PubChem CID | 1334368 |
| Molecular Formula | C21H19ClN2O4S |
| Molecular Weight | 430.91 g/mol |
| Exact Mass | 430.08 |
| IUPAC Name | 2-(4-chloro-N-(4-methoxyphenyl)sulfonylanilino)-N-phenylacetamide |
| SMILES | COc1ccc(S(=O)(=O)N(CC(=O)Nc2ccccc2)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C21H19ClN2O4S/c1-28-19-11-13-20(14-12-19)29(26,27)24(18-9-7-16(22)8-10-18)15-21(25)23-17-5-3-2-4-6-17/h2-14H,15H2,1H3,(H,23,25) |
| InChIKey | OWIFGXKBGAVVKR-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.91 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |