C18H24N4O3 — CID 133437109
2-methyl-1-[4-(2-methyl-8-nitroquinolin-4-yl)piperazin-1-yl]propan-2-ol (PubChem CID 133437109) has the molecular formula C18H24N4O3 and a molecular weight of 344.42 g/mol. Its IUPAC name is 2-methyl-1-[4-(2-methyl-8-nitroquinolin-4-yl)piperazin-1-yl]propan-2-ol.
| Compound Name | 2-methyl-1-[4-(2-methyl-8-nitroquinolin-4-yl)piperazin-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 133437109 |
| Molecular Formula | C18H24N4O3 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | 2-methyl-1-[4-(2-methyl-8-nitroquinolin-4-yl)piperazin-1-yl]propan-2-ol |
| SMILES | Cc1cc(N2CCN(CC(C)(C)O)CC2)c2cccc([N+](=O)[O-])c2n1 |
| InChI | InChI=1S/C18H24N4O3/c1-13-11-16(14-5-4-6-15(22(24)25)17(14)19-13)21-9-7-20(8-10-21)12-18(2,3)23/h4-6,11,23H,7-10,12H2,1-3H3 |
| InChIKey | HJWQBMLJUSZGPN-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 82.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|