C18H24ClN3O — CID 133437520
2-[[1-(7-chloro-8-methylquinolin-2-yl)piperidin-4-yl]-methylamino]ethanol (PubChem CID 133437520) has the molecular formula C18H24ClN3O and a molecular weight of 333.86 g/mol. Its IUPAC name is 2-[[1-(7-chloro-8-methylquinolin-2-yl)piperidin-4-yl]-methylamino]ethanol.
| Compound Name | 2-[[1-(7-chloro-8-methylquinolin-2-yl)piperidin-4-yl]-methylamino]ethanol |
|---|---|
| PubChem CID | 133437520 |
| Molecular Formula | C18H24ClN3O |
| Molecular Weight | 333.86 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | 2-[[1-(7-chloro-8-methylquinolin-2-yl)piperidin-4-yl]-methylamino]ethanol |
| SMILES | Cc1c(Cl)ccc2ccc(N3CCC(N(C)CCO)CC3)nc12 |
| InChI | InChI=1S/C18H24ClN3O/c1-13-16(19)5-3-14-4-6-17(20-18(13)14)22-9-7-15(8-10-22)21(2)11-12-23/h3-6,15,23H,7-12H2,1-2H3 |
| InChIKey | DXISRIWIBZMXBQ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 39.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.86 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |