C13H20N4O2 — CID 133439410
6-[(2,2,5,5-tetramethyloxolan-3-yl)amino]pyridazine-3-carboxamide (PubChem CID 133439410) has the molecular formula C13H20N4O2 and a molecular weight of 264.33 g/mol. Its IUPAC name is 6-[(2,2,5,5-tetramethyloxolan-3-yl)amino]pyridazine-3-carboxamide.
| Compound Name | 6-[(2,2,5,5-tetramethyloxolan-3-yl)amino]pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 133439410 |
| Molecular Formula | C13H20N4O2 |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | 6-[(2,2,5,5-tetramethyloxolan-3-yl)amino]pyridazine-3-carboxamide |
| SMILES | CC1(C)CC(Nc2ccc(C(N)=O)nn2)C(C)(C)O1 |
| InChI | InChI=1S/C13H20N4O2/c1-12(2)7-9(13(3,4)19-12)15-10-6-5-8(11(14)18)16-17-10/h5-6,9H,7H2,1-4H3,(H2,14,18)(H,15,17) |
| InChIKey | WJSCUMIDUPAUER-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |