C13H18N4O2S — CID 133439502
2-[(2,2,5,5-tetramethyloxolan-3-yl)amino]-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one (PubChem CID 133439502) has the molecular formula C13H18N4O2S and a molecular weight of 294.38 g/mol. Its IUPAC name is 2-[(2,2,5,5-tetramethyloxolan-3-yl)amino]-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one.
| Compound Name | 2-[(2,2,5,5-tetramethyloxolan-3-yl)amino]-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one |
|---|---|
| PubChem CID | 133439502 |
| Molecular Formula | C13H18N4O2S |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 2-[(2,2,5,5-tetramethyloxolan-3-yl)amino]-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one |
| SMILES | CC1(C)CC(Nc2nn3c(=O)ccnc3s2)C(C)(C)O1 |
| InChI | InChI=1S/C13H18N4O2S/c1-12(2)7-8(13(3,4)19-12)15-10-16-17-9(18)5-6-14-11(17)20-10/h5-6,8H,7H2,1-4H3,(H,15,16) |
| InChIKey | FOFLKZBCAOBGLO-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |