About 2-[propylsulfanyl(2,2,2-trifluoroethoxy)phosphoryl]sulfanylbutane
2-[propylsulfanyl(2,2,2-trifluoroethoxy)phosphoryl]sulfanylbutane (PubChem CID 13343966) has the molecular formula C9H18F3O2PS2
and a molecular weight of 310.34 g/mol. Its IUPAC name is 2-[propylsulfanyl(2,2,2-trifluoroethoxy)phosphoryl]sulfanylbutane.
Molecular Properties
| Compound Name | 2-[propylsulfanyl(2,2,2-trifluoroethoxy)phosphoryl]sulfanylbutane |
| PubChem CID | 13343966 |
| Molecular Formula | C9H18F3O2PS2 |
| Molecular Weight | 310.34 g/mol |
| Exact Mass | 310.04 |
| IUPAC Name | 2-[propylsulfanyl(2,2,2-trifluoroethoxy)phosphoryl]sulfanylbutane |
| SMILES | CCCSP(=O)(OCC(F)(F)F)SC(C)CC |
| InChI | InChI=1S/C9H18F3O2PS2/c1-4-6-16-15(13,17-8(3)5-2)14-7-9(10,11)12/h8H,4-7H2,1-3H3 |
| InChIKey | HDAMBCVGHHZFJM-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 310.34 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-[propylsulfanyl(2,2,2-trifluoroethoxy)phosphoryl]sulfanylbutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[propylsulfanyl(2,2,2-trifluoroethoxy)phosphoryl]sulfanylbutane?
The IUPAC name of 2-[propylsulfanyl(2,2,2-trifluoroethoxy)phosphoryl]sulfanylbutane (CID 13343966) is 2-[propylsulfanyl(2,2,2-trifluoroethoxy)phosphoryl]sulfanylbutane.
What is the SMILES notation for 2-[propylsulfanyl(2,2,2-trifluoroethoxy)phosphoryl]sulfanylbutane?
The canonical SMILES for 2-[propylsulfanyl(2,2,2-trifluoroethoxy)phosphoryl]sulfanylbutane is CCCSP(=O)(OCC(F)(F)F)SC(C)CC.
What is the InChIKey of 2-[propylsulfanyl(2,2,2-trifluoroethoxy)phosphoryl]sulfanylbutane?
The InChIKey is HDAMBCVGHHZFJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18F3O2PS2/c1-4-6-16-15(13,17-8(3)5-2)14-7-9(10,11)12/h8H,4-7H2,1-3H3.
What are the key properties of 2-[propylsulfanyl(2,2,2-trifluoroethoxy)phosphoryl]sulfanylbutane?
2-[propylsulfanyl(2,2,2-trifluoroethoxy)phosphoryl]sulfanylbutane has a molecular weight of 310.34 g/mol, XLogP of 5.35, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[propylsulfanyl(2,2,2-trifluoroethoxy)phosphoryl]sulfanylbutane is sourced from PubChem (CID 13343966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).