C19H24FN3O2S — CID 133439673
3-fluoro-N-methyl-4-[(2-piperidin-1-ylphenyl)methylamino]benzenesulfonamide (PubChem CID 133439673) has the molecular formula C19H24FN3O2S and a molecular weight of 377.49 g/mol. Its IUPAC name is 3-fluoro-N-methyl-4-[(2-piperidin-1-ylphenyl)methylamino]benzenesulfonamide.
| Compound Name | 3-fluoro-N-methyl-4-[(2-piperidin-1-ylphenyl)methylamino]benzenesulfonamide |
|---|---|
| PubChem CID | 133439673 |
| Molecular Formula | C19H24FN3O2S |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | 3-fluoro-N-methyl-4-[(2-piperidin-1-ylphenyl)methylamino]benzenesulfonamide |
| SMILES | CNS(=O)(=O)c1ccc(NCc2ccccc2N2CCCCC2)c(F)c1 |
| InChI | InChI=1S/C19H24FN3O2S/c1-21-26(24,25)16-9-10-18(17(20)13-16)22-14-15-7-3-4-8-19(15)23-11-5-2-6-12-23/h3-4,7-10,13,21-22H,2,5-6,11-12,14H2,1H3 |
| InChIKey | LTEJADOULFAOEO-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |