About 4-fluoro-N-(pyrazolo[1,5-a]pyrimidin-7-ylmethyl)-2-(trifluoromethylsulfonyl)aniline
4-fluoro-N-(pyrazolo[1,5-a]pyrimidin-7-ylmethyl)-2-(trifluoromethylsulfonyl)aniline (PubChem CID 133439954) has the molecular formula C14H10F4N4O2S
and a molecular weight of 374.32 g/mol. Its IUPAC name is 4-fluoro-N-(pyrazolo[1,5-a]pyrimidin-7-ylmethyl)-2-(trifluoromethylsulfonyl)aniline.
Molecular Properties
| Compound Name | 4-fluoro-N-(pyrazolo[1,5-a]pyrimidin-7-ylmethyl)-2-(trifluoromethylsulfonyl)aniline |
| PubChem CID | 133439954 |
| Molecular Formula | C14H10F4N4O2S |
| Molecular Weight | 374.32 g/mol |
| Exact Mass | 374.05 |
| IUPAC Name | 4-fluoro-N-(pyrazolo[1,5-a]pyrimidin-7-ylmethyl)-2-(trifluoromethylsulfonyl)aniline |
| SMILES | O=S(=O)(c1cc(F)ccc1NCc1ccnc2ccnn12)C(F)(F)F |
| InChI | InChI=1S/C14H10F4N4O2S/c15-9-1-2-11(12(7-9)25(23,24)14(16,17)18)20-8-10-3-5-19-13-4-6-21-22(10)13/h1-7,20H,8H2 |
| InChIKey | HHGYDHCYALFWKO-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.32 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-fluoro-N-(pyrazolo[1,5-a]pyrimidin-7-ylmethyl)-2-(trifluoromethylsulfonyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-N-(pyrazolo[1,5-a]pyrimidin-7-ylmethyl)-2-(trifluoromethylsulfonyl)aniline?
The IUPAC name of 4-fluoro-N-(pyrazolo[1,5-a]pyrimidin-7-ylmethyl)-2-(trifluoromethylsulfonyl)aniline (CID 133439954) is 4-fluoro-N-(pyrazolo[1,5-a]pyrimidin-7-ylmethyl)-2-(trifluoromethylsulfonyl)aniline.
What is the SMILES notation for 4-fluoro-N-(pyrazolo[1,5-a]pyrimidin-7-ylmethyl)-2-(trifluoromethylsulfonyl)aniline?
The canonical SMILES for 4-fluoro-N-(pyrazolo[1,5-a]pyrimidin-7-ylmethyl)-2-(trifluoromethylsulfonyl)aniline is O=S(=O)(c1cc(F)ccc1NCc1ccnc2ccnn12)C(F)(F)F.
What is the InChIKey of 4-fluoro-N-(pyrazolo[1,5-a]pyrimidin-7-ylmethyl)-2-(trifluoromethylsulfonyl)aniline?
The InChIKey is HHGYDHCYALFWKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10F4N4O2S/c15-9-1-2-11(12(7-9)25(23,24)14(16,17)18)20-8-10-3-5-19-13-4-6-21-22(10)13/h1-7,20H,8H2.
What are the key properties of 4-fluoro-N-(pyrazolo[1,5-a]pyrimidin-7-ylmethyl)-2-(trifluoromethylsulfonyl)aniline?
4-fluoro-N-(pyrazolo[1,5-a]pyrimidin-7-ylmethyl)-2-(trifluoromethylsulfonyl)aniline has a molecular weight of 374.32 g/mol, XLogP of 2.77, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-N-(pyrazolo[1,5-a]pyrimidin-7-ylmethyl)-2-(trifluoromethylsulfonyl)aniline is sourced from PubChem (CID 133439954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).