C15H22N6O3 — CID 133440566
3-[[4-(3-ethyl-1-methyl-4-nitropyrazol-5-yl)piperazin-1-yl]methyl]-5-methyl-1,2-oxazole (PubChem CID 133440566) has the molecular formula C15H22N6O3 and a molecular weight of 334.38 g/mol. Its IUPAC name is 3-[[4-(3-ethyl-1-methyl-4-nitropyrazol-5-yl)piperazin-1-yl]methyl]-5-methyl-1,2-oxazole.
| Compound Name | 3-[[4-(3-ethyl-1-methyl-4-nitropyrazol-5-yl)piperazin-1-yl]methyl]-5-methyl-1,2-oxazole |
|---|---|
| PubChem CID | 133440566 |
| Molecular Formula | C15H22N6O3 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | 3-[[4-(3-ethyl-1-methyl-4-nitropyrazol-5-yl)piperazin-1-yl]methyl]-5-methyl-1,2-oxazole |
| SMILES | CCc1nn(C)c(N2CCN(Cc3cc(C)on3)CC2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C15H22N6O3/c1-4-13-14(21(22)23)15(18(3)16-13)20-7-5-19(6-8-20)10-12-9-11(2)24-17-12/h9H,4-8,10H2,1-3H3 |
| InChIKey | UYEDXBCDGDYTPC-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 93.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|