C17H21N3O — CID 133442890
4-acetyl-2-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)benzonitrile (PubChem CID 133442890) has the molecular formula C17H21N3O and a molecular weight of 283.38 g/mol. Its IUPAC name is 4-acetyl-2-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)benzonitrile.
| Compound Name | 4-acetyl-2-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)benzonitrile |
|---|---|
| PubChem CID | 133442890 |
| Molecular Formula | C17H21N3O |
| Molecular Weight | 283.38 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | 4-acetyl-2-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)benzonitrile |
| SMILES | CC(=O)c1ccc(C#N)c(N2CCN3CCCCC3C2)c1 |
| InChI | InChI=1S/C17H21N3O/c1-13(21)14-5-6-15(11-18)17(10-14)20-9-8-19-7-3-2-4-16(19)12-20/h5-6,10,16H,2-4,7-9,12H2,1H3 |
| InChIKey | IPAHTQVYVNFNNW-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 47.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.38 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |