C13H13F3N6OS — CID 133443890
2-[[7,8-dimethyl-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]sulfanyl]-5-propyl-1,3,4-oxadiazole (PubChem CID 133443890) has the molecular formula C13H13F3N6OS and a molecular weight of 358.35 g/mol. Its IUPAC name is 2-[[7,8-dimethyl-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]sulfanyl]-5-propyl-1,3,4-oxadiazole.
| Compound Name | 2-[[7,8-dimethyl-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]sulfanyl]-5-propyl-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 133443890 |
| Molecular Formula | C13H13F3N6OS |
| Molecular Weight | 358.35 g/mol |
| Exact Mass | 358.08 |
| IUPAC Name | 2-[[7,8-dimethyl-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]sulfanyl]-5-propyl-1,3,4-oxadiazole |
| SMILES | CCCc1nnc(Sc2nn3c(C(F)(F)F)nnc3c(C)c2C)o1 |
| InChI | InChI=1S/C13H13F3N6OS/c1-4-5-8-17-20-12(23-8)24-10-7(3)6(2)9-18-19-11(13(14,15)16)22(9)21-10/h4-5H2,1-3H3 |
| InChIKey | XWAKCBRZAAURSY-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 82.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.35 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |