C20H21F3N4 — CID 133445454
2-ethyl-1-[1-[6-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]benzimidazole (PubChem CID 133445454) has the molecular formula C20H21F3N4 and a molecular weight of 374.41 g/mol. Its IUPAC name is 2-ethyl-1-[1-[6-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]benzimidazole.
| Compound Name | 2-ethyl-1-[1-[6-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]benzimidazole |
|---|---|
| PubChem CID | 133445454 |
| Molecular Formula | C20H21F3N4 |
| Molecular Weight | 374.41 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | 2-ethyl-1-[1-[6-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]benzimidazole |
| SMILES | CCc1nc2ccccc2n1C1CCN(c2cccc(C(F)(F)F)n2)CC1 |
| InChI | InChI=1S/C20H21F3N4/c1-2-18-24-15-6-3-4-7-16(15)27(18)14-10-12-26(13-11-14)19-9-5-8-17(25-19)20(21,22)23/h3-9,14H,2,10-13H2,1H3 |
| InChIKey | FCINKIUKBZTZPZ-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.41 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |