C15H17ClN4O — CID 133445835
4-chloro-2-[(3-ethyl-5-methoxy-1-methylpyrazol-4-yl)methylamino]benzonitrile (PubChem CID 133445835) has the molecular formula C15H17ClN4O and a molecular weight of 304.78 g/mol. Its IUPAC name is 4-chloro-2-[(3-ethyl-5-methoxy-1-methylpyrazol-4-yl)methylamino]benzonitrile.
| Compound Name | 4-chloro-2-[(3-ethyl-5-methoxy-1-methylpyrazol-4-yl)methylamino]benzonitrile |
|---|---|
| PubChem CID | 133445835 |
| Molecular Formula | C15H17ClN4O |
| Molecular Weight | 304.78 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | 4-chloro-2-[(3-ethyl-5-methoxy-1-methylpyrazol-4-yl)methylamino]benzonitrile |
| SMILES | CCc1nn(C)c(OC)c1CNc1cc(Cl)ccc1C#N |
| InChI | InChI=1S/C15H17ClN4O/c1-4-13-12(15(21-3)20(2)19-13)9-18-14-7-11(16)6-5-10(14)8-17/h5-7,18H,4,9H2,1-3H3 |
| InChIKey | AEPZTBNIZRZKCS-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 62.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.78 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |