C15H13FN4OS — CID 133446426
2-[(7-fluoro-1,2,3,4-tetrahydronaphthalen-1-yl)amino]-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one (PubChem CID 133446426) has the molecular formula C15H13FN4OS and a molecular weight of 316.36 g/mol. Its IUPAC name is 2-[(7-fluoro-1,2,3,4-tetrahydronaphthalen-1-yl)amino]-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one.
| Compound Name | 2-[(7-fluoro-1,2,3,4-tetrahydronaphthalen-1-yl)amino]-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one |
|---|---|
| PubChem CID | 133446426 |
| Molecular Formula | C15H13FN4OS |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.08 |
| IUPAC Name | 2-[(7-fluoro-1,2,3,4-tetrahydronaphthalen-1-yl)amino]-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one |
| SMILES | O=c1ccnc2sc(NC3CCCc4ccc(F)cc43)nn12 |
| InChI | InChI=1S/C15H13FN4OS/c16-10-5-4-9-2-1-3-12(11(9)8-10)18-14-19-20-13(21)6-7-17-15(20)22-14/h4-8,12H,1-3H2,(H,18,19) |
| InChIKey | HSEKXZQKADSDSA-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 59.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |