C17H18FN5 — CID 133446453
N-(7-fluoro-1,2,3,4-tetrahydronaphthalen-1-yl)-5,6-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine (PubChem CID 133446453) has the molecular formula C17H18FN5 and a molecular weight of 311.36 g/mol. Its IUPAC name is N-(7-fluoro-1,2,3,4-tetrahydronaphthalen-1-yl)-5,6-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | N-(7-fluoro-1,2,3,4-tetrahydronaphthalen-1-yl)-5,6-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 133446453 |
| Molecular Formula | C17H18FN5 |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | N-(7-fluoro-1,2,3,4-tetrahydronaphthalen-1-yl)-5,6-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
| SMILES | Cc1nc2ncnn2c(NC2CCCc3ccc(F)cc32)c1C |
| InChI | InChI=1S/C17H18FN5/c1-10-11(2)21-17-19-9-20-23(17)16(10)22-15-5-3-4-12-6-7-13(18)8-14(12)15/h6-9,15,22H,3-5H2,1-2H3 |
| InChIKey | NWNUYGAYUTUPRB-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 55.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |