About 2-[[4-(3-methyl-1,2,4-oxadiazol-5-yl)-2-pyridinyl]amino]-1-morpholin-4-ylpropan-1-one
2-[[4-(3-methyl-1,2,4-oxadiazol-5-yl)-2-pyridinyl]amino]-1-morpholin-4-ylpropan-1-one (PubChem CID 133447507) has the molecular formula C15H19N5O3
and a molecular weight of 317.35 g/mol. Its IUPAC name is 2-[[4-(3-methyl-1,2,4-oxadiazol-5-yl)-2-pyridinyl]amino]-1-morpholin-4-ylpropan-1-one.
Molecular Properties
| Compound Name | 2-[[4-(3-methyl-1,2,4-oxadiazol-5-yl)-2-pyridinyl]amino]-1-morpholin-4-ylpropan-1-one |
| PubChem CID | 133447507 |
| Molecular Formula | C15H19N5O3 |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.15 |
| IUPAC Name | 2-[[4-(3-methyl-1,2,4-oxadiazol-5-yl)-2-pyridinyl]amino]-1-morpholin-4-ylpropan-1-one |
| SMILES | Cc1noc(-c2ccnc(NC(C)C(=O)N3CCOCC3)c2)n1 |
| InChI | InChI=1S/C15H19N5O3/c1-10(15(21)20-5-7-22-8-6-20)17-13-9-12(3-4-16-13)14-18-11(2)19-23-14/h3-4,9-10H,5-8H2,1-2H3,(H,16,17) |
| InChIKey | SJPKXXGFAIAIEB-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 93.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-[[4-(3-methyl-1,2,4-oxadiazol-5-yl)-2-pyridinyl]amino]-1-morpholin-4-ylpropan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[4-(3-methyl-1,2,4-oxadiazol-5-yl)-2-pyridinyl]amino]-1-morpholin-4-ylpropan-1-one?
The IUPAC name of 2-[[4-(3-methyl-1,2,4-oxadiazol-5-yl)-2-pyridinyl]amino]-1-morpholin-4-ylpropan-1-one (CID 133447507) is 2-[[4-(3-methyl-1,2,4-oxadiazol-5-yl)-2-pyridinyl]amino]-1-morpholin-4-ylpropan-1-one.
What is the SMILES notation for 2-[[4-(3-methyl-1,2,4-oxadiazol-5-yl)-2-pyridinyl]amino]-1-morpholin-4-ylpropan-1-one?
The canonical SMILES for 2-[[4-(3-methyl-1,2,4-oxadiazol-5-yl)-2-pyridinyl]amino]-1-morpholin-4-ylpropan-1-one is Cc1noc(-c2ccnc(NC(C)C(=O)N3CCOCC3)c2)n1.
What is the InChIKey of 2-[[4-(3-methyl-1,2,4-oxadiazol-5-yl)-2-pyridinyl]amino]-1-morpholin-4-ylpropan-1-one?
The InChIKey is SJPKXXGFAIAIEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19N5O3/c1-10(15(21)20-5-7-22-8-6-20)17-13-9-12(3-4-16-13)14-18-11(2)19-23-14/h3-4,9-10H,5-8H2,1-2H3,(H,16,17).
What are the key properties of 2-[[4-(3-methyl-1,2,4-oxadiazol-5-yl)-2-pyridinyl]amino]-1-morpholin-4-ylpropan-1-one?
2-[[4-(3-methyl-1,2,4-oxadiazol-5-yl)-2-pyridinyl]amino]-1-morpholin-4-ylpropan-1-one has a molecular weight of 317.35 g/mol, XLogP of 1.10, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[4-(3-methyl-1,2,4-oxadiazol-5-yl)-2-pyridinyl]amino]-1-morpholin-4-ylpropan-1-one is sourced from PubChem (CID 133447507), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).