C21H23FN4O2 — CID 133448317
ethyl 6-fluoro-4-[3-(1H-imidazol-2-yl)piperidin-1-yl]-8-methylquinoline-3-carboxylate (PubChem CID 133448317) has the molecular formula C21H23FN4O2 and a molecular weight of 382.44 g/mol. Its IUPAC name is ethyl 6-fluoro-4-[3-(1H-imidazol-2-yl)piperidin-1-yl]-8-methylquinoline-3-carboxylate.
| Compound Name | ethyl 6-fluoro-4-[3-(1H-imidazol-2-yl)piperidin-1-yl]-8-methylquinoline-3-carboxylate |
|---|---|
| PubChem CID | 133448317 |
| Molecular Formula | C21H23FN4O2 |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | ethyl 6-fluoro-4-[3-(1H-imidazol-2-yl)piperidin-1-yl]-8-methylquinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cnc2c(C)cc(F)cc2c1N1CCCC(c2ncc[nH]2)C1 |
| InChI | InChI=1S/C21H23FN4O2/c1-3-28-21(27)17-11-25-18-13(2)9-15(22)10-16(18)19(17)26-8-4-5-14(12-26)20-23-6-7-24-20/h6-7,9-11,14H,3-5,8,12H2,1-2H3,(H,23,24) |
| InChIKey | RRFWLXHWNQGXHL-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |