C15H19BrN6O2 — CID 133448992
3-bromo-5-nitro-4-[3-(4-propan-2-yl-1,2,4-triazol-3-yl)piperidin-1-yl]pyridine (PubChem CID 133448992) has the molecular formula C15H19BrN6O2 and a molecular weight of 395.26 g/mol. Its IUPAC name is 3-bromo-5-nitro-4-[3-(4-propan-2-yl-1,2,4-triazol-3-yl)piperidin-1-yl]pyridine.
| Compound Name | 3-bromo-5-nitro-4-[3-(4-propan-2-yl-1,2,4-triazol-3-yl)piperidin-1-yl]pyridine |
|---|---|
| PubChem CID | 133448992 |
| Molecular Formula | C15H19BrN6O2 |
| Molecular Weight | 395.26 g/mol |
| Exact Mass | 394.08 |
| IUPAC Name | 3-bromo-5-nitro-4-[3-(4-propan-2-yl-1,2,4-triazol-3-yl)piperidin-1-yl]pyridine |
| SMILES | CC(C)n1cnnc1C1CCCN(c2c(Br)cncc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C15H19BrN6O2/c1-10(2)21-9-18-19-15(21)11-4-3-5-20(8-11)14-12(16)6-17-7-13(14)22(23)24/h6-7,9-11H,3-5,8H2,1-2H3 |
| InChIKey | ZLEXSXMSCOPTDE-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.26 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|