C11H8ClN3S — CID 13344906
8-chloro-6,11-dihydroimidazo[1,2-c][1,3]benzodiazepine-5-thione (PubChem CID 13344906) has the molecular formula C11H8ClN3S and a molecular weight of 249.73 g/mol. Its IUPAC name is 8-chloro-6,11-dihydroimidazo[1,2-c][1,3]benzodiazepine-5-thione.
| Compound Name | 8-chloro-6,11-dihydroimidazo[1,2-c][1,3]benzodiazepine-5-thione |
|---|---|
| PubChem CID | 13344906 |
| Molecular Formula | C11H8ClN3S |
| Molecular Weight | 249.73 g/mol |
| Exact Mass | 249.01 |
| IUPAC Name | 8-chloro-6,11-dihydroimidazo[1,2-c][1,3]benzodiazepine-5-thione |
| SMILES | S=C1Nc2cc(Cl)ccc2Cc2nccn21 |
| InChI | InChI=1S/C11H8ClN3S/c12-8-2-1-7-5-10-13-3-4-15(10)11(16)14-9(7)6-8/h1-4,6H,5H2,(H,14,16) |
| InChIKey | JJVMYPPHGUCTGQ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.73 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|