C15H17N7 — CID 133449281
6-ethyl-2-pyridin-4-yl-N-[2-(triazol-1-yl)ethyl]pyrimidin-4-amine (PubChem CID 133449281) has the molecular formula C15H17N7 and a molecular weight of 295.35 g/mol. Its IUPAC name is 6-ethyl-2-pyridin-4-yl-N-[2-(triazol-1-yl)ethyl]pyrimidin-4-amine.
| Compound Name | 6-ethyl-2-pyridin-4-yl-N-[2-(triazol-1-yl)ethyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 133449281 |
| Molecular Formula | C15H17N7 |
| Molecular Weight | 295.35 g/mol |
| Exact Mass | 295.15 |
| IUPAC Name | 6-ethyl-2-pyridin-4-yl-N-[2-(triazol-1-yl)ethyl]pyrimidin-4-amine |
| SMILES | CCc1cc(NCCn2ccnn2)nc(-c2ccncc2)n1 |
| InChI | InChI=1S/C15H17N7/c1-2-13-11-14(17-7-9-22-10-8-18-21-22)20-15(19-13)12-3-5-16-6-4-12/h3-6,8,10-11H,2,7,9H2,1H3,(H,17,19,20) |
| InChIKey | XFDQLAVTSQMCLV-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 81.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.35 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |