About methyl 4-fluoro-3-[[(5-methyl-1,3,4-thiadiazol-2-yl)amino]methyl]benzoate
methyl 4-fluoro-3-[[(5-methyl-1,3,4-thiadiazol-2-yl)amino]methyl]benzoate (PubChem CID 133449555) has the molecular formula C12H12FN3O2S
and a molecular weight of 281.31 g/mol. Its IUPAC name is methyl 4-fluoro-3-[[(5-methyl-1,3,4-thiadiazol-2-yl)amino]methyl]benzoate.
Molecular Properties
| Compound Name | methyl 4-fluoro-3-[[(5-methyl-1,3,4-thiadiazol-2-yl)amino]methyl]benzoate |
| PubChem CID | 133449555 |
| Molecular Formula | C12H12FN3O2S |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.06 |
| IUPAC Name | methyl 4-fluoro-3-[[(5-methyl-1,3,4-thiadiazol-2-yl)amino]methyl]benzoate |
| SMILES | COC(=O)c1ccc(F)c(CNc2nnc(C)s2)c1 |
| InChI | InChI=1S/C12H12FN3O2S/c1-7-15-16-12(19-7)14-6-9-5-8(11(17)18-2)3-4-10(9)13/h3-5H,6H2,1-2H3,(H,14,16) |
| InChIKey | ZOFDOPJLGXIQGZ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 4-fluoro-3-[[(5-methyl-1,3,4-thiadiazol-2-yl)amino]methyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-fluoro-3-[[(5-methyl-1,3,4-thiadiazol-2-yl)amino]methyl]benzoate?
The IUPAC name of methyl 4-fluoro-3-[[(5-methyl-1,3,4-thiadiazol-2-yl)amino]methyl]benzoate (CID 133449555) is methyl 4-fluoro-3-[[(5-methyl-1,3,4-thiadiazol-2-yl)amino]methyl]benzoate.
What is the SMILES notation for methyl 4-fluoro-3-[[(5-methyl-1,3,4-thiadiazol-2-yl)amino]methyl]benzoate?
The canonical SMILES for methyl 4-fluoro-3-[[(5-methyl-1,3,4-thiadiazol-2-yl)amino]methyl]benzoate is COC(=O)c1ccc(F)c(CNc2nnc(C)s2)c1.
What is the InChIKey of methyl 4-fluoro-3-[[(5-methyl-1,3,4-thiadiazol-2-yl)amino]methyl]benzoate?
The InChIKey is ZOFDOPJLGXIQGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12FN3O2S/c1-7-15-16-12(19-7)14-6-9-5-8(11(17)18-2)3-4-10(9)13/h3-5H,6H2,1-2H3,(H,14,16).
What are the key properties of methyl 4-fluoro-3-[[(5-methyl-1,3,4-thiadiazol-2-yl)amino]methyl]benzoate?
methyl 4-fluoro-3-[[(5-methyl-1,3,4-thiadiazol-2-yl)amino]methyl]benzoate has a molecular weight of 281.31 g/mol, XLogP of 2.38, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-fluoro-3-[[(5-methyl-1,3,4-thiadiazol-2-yl)amino]methyl]benzoate is sourced from PubChem (CID 133449555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).