About methyl 3-[[(5-tert-butyl-1,3,4-thiadiazol-2-yl)amino]methyl]-4-fluorobenzoate
methyl 3-[[(5-tert-butyl-1,3,4-thiadiazol-2-yl)amino]methyl]-4-fluorobenzoate (PubChem CID 133449738) has the molecular formula C15H18FN3O2S
and a molecular weight of 323.39 g/mol. Its IUPAC name is methyl 3-[[(5-tert-butyl-1,3,4-thiadiazol-2-yl)amino]methyl]-4-fluorobenzoate.
Molecular Properties
| Compound Name | methyl 3-[[(5-tert-butyl-1,3,4-thiadiazol-2-yl)amino]methyl]-4-fluorobenzoate |
| PubChem CID | 133449738 |
| Molecular Formula | C15H18FN3O2S |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | methyl 3-[[(5-tert-butyl-1,3,4-thiadiazol-2-yl)amino]methyl]-4-fluorobenzoate |
| SMILES | COC(=O)c1ccc(F)c(CNc2nnc(C(C)(C)C)s2)c1 |
| InChI | InChI=1S/C15H18FN3O2S/c1-15(2,3)13-18-19-14(22-13)17-8-10-7-9(12(20)21-4)5-6-11(10)16/h5-7H,8H2,1-4H3,(H,17,19) |
| InChIKey | NRZOLYXTXOLLIX-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 3-[[(5-tert-butyl-1,3,4-thiadiazol-2-yl)amino]methyl]-4-fluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[[(5-tert-butyl-1,3,4-thiadiazol-2-yl)amino]methyl]-4-fluorobenzoate?
The IUPAC name of methyl 3-[[(5-tert-butyl-1,3,4-thiadiazol-2-yl)amino]methyl]-4-fluorobenzoate (CID 133449738) is methyl 3-[[(5-tert-butyl-1,3,4-thiadiazol-2-yl)amino]methyl]-4-fluorobenzoate.
What is the SMILES notation for methyl 3-[[(5-tert-butyl-1,3,4-thiadiazol-2-yl)amino]methyl]-4-fluorobenzoate?
The canonical SMILES for methyl 3-[[(5-tert-butyl-1,3,4-thiadiazol-2-yl)amino]methyl]-4-fluorobenzoate is COC(=O)c1ccc(F)c(CNc2nnc(C(C)(C)C)s2)c1.
What is the InChIKey of methyl 3-[[(5-tert-butyl-1,3,4-thiadiazol-2-yl)amino]methyl]-4-fluorobenzoate?
The InChIKey is NRZOLYXTXOLLIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18FN3O2S/c1-15(2,3)13-18-19-14(22-13)17-8-10-7-9(12(20)21-4)5-6-11(10)16/h5-7H,8H2,1-4H3,(H,17,19).
What are the key properties of methyl 3-[[(5-tert-butyl-1,3,4-thiadiazol-2-yl)amino]methyl]-4-fluorobenzoate?
methyl 3-[[(5-tert-butyl-1,3,4-thiadiazol-2-yl)amino]methyl]-4-fluorobenzoate has a molecular weight of 323.39 g/mol, XLogP of 3.37, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[[(5-tert-butyl-1,3,4-thiadiazol-2-yl)amino]methyl]-4-fluorobenzoate is sourced from PubChem (CID 133449738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).